C21H29FO5S — CID 54104513
2-(4-fluorophenyl)-7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]heptanoic acid (PubChem CID 54104513) has the molecular formula C21H29FO5S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-(4-fluorophenyl)-7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54104513 |
| Molecular Formula | C21H29FO5S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-(4-fluorophenyl)-7-[(1S,2R)-3-hydroxy-2-(2-hydroxypropylsulfanyl)-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC(O)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCC(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FO5S/c1-13(23)12-28-20-17(18(24)11-19(20)25)6-4-2-3-5-16(21(26)27)14-7-9-15(22)10-8-14/h7-10,13,16-17,19-20,23,25H,2-6,11-12H2,1H3,(H,26,27)/t13?,16?,17-,19?,20+/m0/s1 |
| InChIKey | NCUKFJRNTXLEOU-GAUALXERSA-N |
| XLogP | 3.38 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|