C22H34O5S — CID 54118558
7-[(1S,2R)-3,5-dihydroxy-2-(2-hydroxypropylsulfanyl)cyclopentyl]-2-(4-methylphenyl)heptanoic acid (PubChem CID 54118558) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is 7-[(1S,2R)-3,5-dihydroxy-2-(2-hydroxypropylsulfanyl)cyclopentyl]-2-(4-methylphenyl)heptanoic acid.
| Compound Name | 7-[(1S,2R)-3,5-dihydroxy-2-(2-hydroxypropylsulfanyl)cyclopentyl]-2-(4-methylphenyl)heptanoic acid |
|---|---|
| PubChem CID | 54118558 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 7-[(1S,2R)-3,5-dihydroxy-2-(2-hydroxypropylsulfanyl)cyclopentyl]-2-(4-methylphenyl)heptanoic acid |
| SMILES | Cc1ccc(C(CCCCC[C@H]2C(O)CC(O)[C@@H]2SCC(C)O)C(=O)O)cc1 |
| InChI | InChI=1S/C22H34O5S/c1-14-8-10-16(11-9-14)17(22(26)27)6-4-3-5-7-18-19(24)12-20(25)21(18)28-13-15(2)23/h8-11,15,17-21,23-25H,3-7,12-13H2,1-2H3,(H,26,27)/t15?,17?,18-,19?,20?,21+/m0/s1 |
| InChIKey | NMARSRDOMKZXHL-RUFQXSLQSA-N |
| XLogP | 3.34 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|