C26H36O5 — CID 70853038
7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-(6-methylnaphthalen-2-yl)propyl]cyclopentyl]heptanoic acid (PubChem CID 70853038) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-(6-methylnaphthalen-2-yl)propyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-(6-methylnaphthalen-2-yl)propyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70853038 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 7-[(1R,3R,5S)-3,5-dihydroxy-2-[3-hydroxy-3-(6-methylnaphthalen-2-yl)propyl]cyclopentyl]heptanoic acid |
| SMILES | Cc1ccc2cc(C(O)CCC3[C@H](O)C[C@H](O)[C@@H]3CCCCCCC(=O)O)ccc2c1 |
| InChI | InChI=1S/C26H36O5/c1-17-8-9-19-15-20(11-10-18(19)14-17)23(27)13-12-22-21(24(28)16-25(22)29)6-4-2-3-5-7-26(30)31/h8-11,14-15,21-25,27-29H,2-7,12-13,16H2,1H3,(H,30,31)/t21-,22?,23?,24+,25-/m1/s1 |
| InChIKey | FIDHWXAJCRMXOD-QUFPEAKPSA-N |
| XLogP | 4.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|