C23H33ClO5 — CID 59922178
7-[(1R,2R,3R,5S)-2-[(E)-5-(4-chlorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 59922178) has the molecular formula C23H33ClO5 and a molecular weight of 424.97 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(E)-5-(4-chlorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(E)-5-(4-chlorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59922178 |
| Molecular Formula | C23H33ClO5 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(E)-5-(4-chlorophenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CCC(O)/C=C/c2ccc(Cl)cc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H33ClO5/c24-17-10-7-16(8-11-17)9-12-18(25)13-14-20-19(21(26)15-22(20)27)5-3-1-2-4-6-23(28)29/h7-12,18-22,25-27H,1-6,13-15H2,(H,28,29)/b12-9+/t18?,19-,20-,21+,22-/m1/s1 |
| InChIKey | JMDJSYKTPLCWLR-KVEHSOBXSA-N |
| XLogP | 4.28 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|