C24H33FO6 — CID 126625980
7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluoro-3-formylphenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 126625980) has the molecular formula C24H33FO6 and a molecular weight of 436.52 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluoro-3-formylphenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluoro-3-formylphenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 126625980 |
| Molecular Formula | C24H33FO6 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(E)-5-(2-fluoro-3-formylphenyl)-3-hydroxypent-4-enyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=Cc1cccc(/C=C/C(O)CC[C@@H]2[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]2O)c1F |
| InChI | InChI=1S/C24H33FO6/c25-24-16(6-5-7-17(24)15-26)10-11-18(27)12-13-20-19(21(28)14-22(20)29)8-3-1-2-4-9-23(30)31/h5-7,10-11,15,18-22,27-29H,1-4,8-9,12-14H2,(H,30,31)/b11-10+/t18?,19-,20-,21+,22-/m1/s1 |
| InChIKey | WNVCPSZACCCJOC-IKSBHOJWSA-N |
| XLogP | 3.58 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|