C23H30F2O5 — CID 154531014
7-[(2R,3R,5S)-2-[5-(2,3-difluorophenyl)-3-hydroxypent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 154531014) has the molecular formula C23H30F2O5 and a molecular weight of 424.48 g/mol. Its IUPAC name is 7-[(2R,3R,5S)-2-[5-(2,3-difluorophenyl)-3-hydroxypent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R,3R,5S)-2-[5-(2,3-difluorophenyl)-3-hydroxypent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 154531014 |
| Molecular Formula | C23H30F2O5 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 7-[(2R,3R,5S)-2-[5-(2,3-difluorophenyl)-3-hydroxypent-4-ynyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1[C@@H](CCC(O)C#Cc2cccc(F)c2F)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H30F2O5/c24-19-8-5-6-15(23(19)25)10-11-16(26)12-13-18-17(20(27)14-21(18)28)7-3-1-2-4-9-22(29)30/h5-6,8,16-18,20-21,26-28H,1-4,7,9,12-14H2,(H,29,30)/t16?,17?,18-,20+,21-/m1/s1 |
| InChIKey | YGJUBZDNZVTIMO-LBPCWZNXSA-N |
| XLogP | 3.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|