C23H34O7 — CID 22811918
7-[(1R,2R,3R,5S)-2-[(3S)-3-[(2R)-4H-1,3-benzodioxin-2-yl]-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 22811918) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3S)-3-[(2R)-4H-1,3-benzodioxin-2-yl]-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3S)-3-[(2R)-4H-1,3-benzodioxin-2-yl]-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22811918 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3S)-3-[(2R)-4H-1,3-benzodioxin-2-yl]-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CC[C@H](O)[C@@H]2OCc3ccccc3O2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H34O7/c24-18(23-29-14-15-7-5-6-9-21(15)30-23)12-11-17-16(19(25)13-20(17)26)8-3-1-2-4-10-22(27)28/h5-7,9,16-20,23-26H,1-4,8,10-14H2,(H,27,28)/t16-,17-,18+,19+,20-,23-/m1/s1 |
| InChIKey | YUDBFAILSQUJHR-TYUQVFQOSA-N |
| XLogP | 2.85 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|