C33H48O9 — CID 57255292
7-[(1R,2R,3R,5S)-2-[(3R)-3-(4H-1,3-benzodioxin-2-yl)-3-(oxan-2-yloxy)propyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 57255292) has the molecular formula C33H48O9 and a molecular weight of 588.74 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3R)-3-(4H-1,3-benzodioxin-2-yl)-3-(oxan-2-yloxy)propyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3R)-3-(4H-1,3-benzodioxin-2-yl)-3-(oxan-2-yloxy)propyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57255292 |
| Molecular Formula | C33H48O9 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3R)-3-(4H-1,3-benzodioxin-2-yl)-3-(oxan-2-yloxy)propyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](CC[C@@H](OC2CCCCO2)C2OCc3ccccc3O2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C33H48O9/c34-26-21-29(41-32-16-8-10-20-38-32)25(24(26)12-3-1-2-4-14-30(35)36)17-18-28(40-31-15-7-9-19-37-31)33-39-22-23-11-5-6-13-27(23)42-33/h1,3,5-6,11,13,24-26,28-29,31-34H,2,4,7-10,12,14-22H2,(H,35,36)/t24-,25-,26+,28-,29-,31?,32?,33?/m1/s1 |
| InChIKey | NKJORYSZNGOGFY-HLAWGQBBSA-N |
| XLogP | 5.72 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|