C27H40O6 — CID 88826697
2-[5-hydroxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenylbutyl]cyclopentyl]acetaldehyde (PubChem CID 88826697) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is 2-[5-hydroxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenylbutyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[5-hydroxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenylbutyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 88826697 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 2-[5-hydroxy-3-(oxan-2-yloxy)-2-[3-(oxan-2-yloxy)-4-phenylbutyl]cyclopentyl]acetaldehyde |
| SMILES | O=CCC1C(O)CC(OC2CCCCO2)C1CCC(Cc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C27H40O6/c28-15-14-22-23(25(19-24(22)29)33-27-11-5-7-17-31-27)13-12-21(18-20-8-2-1-3-9-20)32-26-10-4-6-16-30-26/h1-3,8-9,15,21-27,29H,4-7,10-14,16-19H2 |
| InChIKey | MJFUIXQKLACGJO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|