C22H30O4 — CID 173446357
2-[2-hydroxy-5-[3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl]acetaldehyde (PubChem CID 173446357) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[2-hydroxy-5-[3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 173446357 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[2-hydroxy-5-[3-(oxan-2-yloxy)-4-phenylbut-1-enyl]cyclopentyl]acetaldehyde |
| SMILES | O=CCC1C(O)CCC1C=CC(Cc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C22H30O4/c23-14-13-20-18(10-12-21(20)24)9-11-19(16-17-6-2-1-3-7-17)26-22-8-4-5-15-25-22/h1-3,6-7,9,11,14,18-22,24H,4-5,8,10,12-13,15-16H2 |
| InChIKey | XZIQFDZJKKXVGI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|