C17H22O4 — CID 70561765
2-[(1S,2R,5S)-2-hydroxy-5-(3-hydroxy-4-phenylbut-1-enyl)cyclopentyl]acetic acid (PubChem CID 70561765) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[(1S,2R,5S)-2-hydroxy-5-(3-hydroxy-4-phenylbut-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2R,5S)-2-hydroxy-5-(3-hydroxy-4-phenylbut-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70561765 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(1S,2R,5S)-2-hydroxy-5-(3-hydroxy-4-phenylbut-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@H](O)CC[C@H]1C=CC(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H22O4/c18-14(10-12-4-2-1-3-5-12)8-6-13-7-9-16(19)15(13)11-17(20)21/h1-6,8,13-16,18-19H,7,9-11H2,(H,20,21)/t13-,14?,15+,16-/m1/s1 |
| InChIKey | BVOZHHUWPKDMGP-HEWHGDCOSA-N |
| XLogP | 2.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|