C20H26O5S2 — CID 10237841
2-[3-[(3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 10237841) has the molecular formula C20H26O5S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[3-[(3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 10237841 |
| Molecular Formula | C20H26O5S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[3-[(3R)-3-hydroxy-2-[(E,3R)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCSC1C(=O)C[C@@H](O)C1/C=C/[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C20H26O5S2/c21-15(11-14-5-2-1-3-6-14)7-8-16-17(22)12-18(23)20(16)27-10-4-9-26-13-19(24)25/h1-3,5-8,15-17,20-22H,4,9-13H2,(H,24,25)/b8-7+/t15-,16?,17+,20?/m0/s1 |
| InChIKey | NEWBNFQOFWWYHJ-SQSXYRGJSA-N |
| XLogP | 2.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|