C23H28O5S3 — CID 10162884
methyl 2-[3-[(1R,2S,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 10162884) has the molecular formula C23H28O5S3 and a molecular weight of 480.67 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 10162884 |
| Molecular Formula | C23H28O5S3 |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 2-[3-[(1R,2S,3R)-2-[(E)-4-(1-benzothiophen-3-yl)-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C23H28O5S3/c1-28-22(27)14-29-9-4-10-30-23-18(19(25)12-20(23)26)8-7-16(24)11-15-13-31-21-6-3-2-5-17(15)21/h2-3,5-8,13,16,18-19,23-25H,4,9-12,14H2,1H3/b8-7+/t16?,18-,19+,23+/m0/s1 |
| InChIKey | ZCSSLPLFOVPJIR-NIZLJWPFSA-N |
| XLogP | 3.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|