C22H29FO5S2 — CID 54065437
2-[3-[(2S)-2-[4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 54065437) has the molecular formula C22H29FO5S2 and a molecular weight of 456.60 g/mol. Its IUPAC name is 2-[3-[(2S)-2-[4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(2S)-2-[4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54065437 |
| Molecular Formula | C22H29FO5S2 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[3-[(2S)-2-[4-[3-(2-fluoroethyl)phenyl]-3-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCSC1C(=O)CC(O)[C@@H]1C=CC(O)Cc1cccc(CCF)c1 |
| InChI | InChI=1S/C22H29FO5S2/c23-8-7-15-3-1-4-16(11-15)12-17(24)5-6-18-19(25)13-20(26)22(18)30-10-2-9-29-14-21(27)28/h1,3-6,11,17-19,22,24-25H,2,7-10,12-14H2,(H,27,28)/t17?,18-,19?,22?/m0/s1 |
| InChIKey | MCPMFIPLUXBACY-ZEVNHLFTSA-N |
| XLogP | 2.92 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|