C24H34O6S2 — CID 54494265
2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-[3-(propan-2-yloxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 54494265) has the molecular formula C24H34O6S2 and a molecular weight of 482.66 g/mol. Its IUPAC name is 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-[3-(propan-2-yloxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-[3-(propan-2-yloxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54494265 |
| Molecular Formula | C24H34O6S2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-[3-(propan-2-yloxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | CC(C)OCc1cccc(CC(O)C=C[C@H]2C(O)CC(=O)C2SCCCSCC(=O)O)c1 |
| InChI | InChI=1S/C24H34O6S2/c1-16(2)30-14-18-6-3-5-17(11-18)12-19(25)7-8-20-21(26)13-22(27)24(20)32-10-4-9-31-15-23(28)29/h3,5-8,11,16,19-21,24-26H,4,9-10,12-15H2,1-2H3,(H,28,29)/t19?,20-,21?,24?/m0/s1 |
| InChIKey | XXYIPKURCSVAKW-ZIBRVTKESA-N |
| XLogP | 3.33 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|