C21H28O5S2 — CID 54348327
2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-(4-methylphenyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 54348327) has the molecular formula C21H28O5S2 and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-(4-methylphenyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-(4-methylphenyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54348327 |
| Molecular Formula | C21H28O5S2 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[3-[(2S)-3-hydroxy-2-[3-hydroxy-4-(4-methylphenyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | Cc1ccc(CC(O)C=C[C@H]2C(O)CC(=O)C2SCCCSCC(=O)O)cc1 |
| InChI | InChI=1S/C21H28O5S2/c1-14-3-5-15(6-4-14)11-16(22)7-8-17-18(23)12-19(24)21(17)28-10-2-9-27-13-20(25)26/h3-8,16-18,21-23H,2,9-13H2,1H3,(H,25,26)/t16?,17-,18?,21?/m0/s1 |
| InChIKey | UDWOCRVBJNZFKS-NXLNGCJJSA-N |
| XLogP | 2.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|