C25H30O5S2 — CID 11294455
2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-1-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 11294455) has the molecular formula C25H30O5S2 and a molecular weight of 474.64 g/mol. Its IUPAC name is 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-1-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-1-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 11294455 |
| Molecular Formula | C25H30O5S2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-1-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H30O5S2/c26-19(10-9-18-7-3-6-17-5-1-2-8-20(17)18)11-12-21-22(27)15-23(28)25(21)32-14-4-13-31-16-24(29)30/h1-3,5-8,11-12,19,21-22,25-27H,4,9-10,13-16H2,(H,29,30)/b12-11+/t19-,21-,22+,25+/m0/s1 |
| InChIKey | JKAHVTRYRUTUAB-BICUVGJISA-N |
| XLogP | 3.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|