C24H30O5S3 — CID 91557000
methyl 2-[3-[(1R,2S,3R)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 91557000) has the molecular formula C24H30O5S3 and a molecular weight of 494.70 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S,3R)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S,3R)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 91557000 |
| Molecular Formula | C24H30O5S3 |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | methyl 2-[3-[(1R,2S,3R)-2-[(3R)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@H](O)CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C24H30O5S3/c1-29-23(28)15-30-11-4-12-31-24-19(20(26)14-21(24)27)10-8-17(25)7-9-18-13-16-5-2-3-6-22(16)32-18/h2-3,5-6,8,10,13,17,19-20,24-26H,4,7,9,11-12,14-15H2,1H3/t17-,19+,20-,24-/m1/s1 |
| InChIKey | XOGDPXOATADPBZ-SSYAZSBWSA-N |
| XLogP | 4.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|