C26H32O4S2 — CID 68558865
methyl 2-[3-[(1R,2S)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 68558865) has the molecular formula C26H32O4S2 and a molecular weight of 472.67 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 68558865 |
| Molecular Formula | C26H32O4S2 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | methyl 2-[3-[(1R,2S)-2-(3-hydroxy-5-naphthalen-2-ylpent-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)CC[C@H]1C=CC(O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32O4S2/c1-30-25(29)18-31-15-4-16-32-26-21(11-14-24(26)28)10-13-23(27)12-8-19-7-9-20-5-2-3-6-22(20)17-19/h2-3,5-7,9-10,13,17,21,23,26-27H,4,8,11-12,14-16,18H2,1H3/t21-,23?,26-/m1/s1 |
| InChIKey | JGWVXHKMBLOONH-XIHZFDFCSA-N |
| XLogP | 5.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|