C27H34O5S2 — CID 163476355
methyl 2-[3-[(1R,2S)-3-hydroxy-2-[(E)-3-hydroxy-3-methyl-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 163476355) has the molecular formula C27H34O5S2 and a molecular weight of 502.70 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S)-3-hydroxy-2-[(E)-3-hydroxy-3-methyl-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S)-3-hydroxy-2-[(E)-3-hydroxy-3-methyl-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 163476355 |
| Molecular Formula | C27H34O5S2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | methyl 2-[3-[(1R,2S)-3-hydroxy-2-[(E)-3-hydroxy-3-methyl-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)CC(O)[C@@H]1/C=C/C(C)(O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H34O5S2/c1-27(31,12-10-19-8-9-20-6-3-4-7-21(20)16-19)13-11-22-23(28)17-24(29)26(22)34-15-5-14-33-18-25(30)32-2/h3-4,6-9,11,13,16,22-23,26,28,31H,5,10,12,14-15,17-18H2,1-2H3/b13-11+/t22-,23?,26+,27?/m0/s1 |
| InChIKey | CATMQDBOEKESJG-VVPOLXOVSA-N |
| XLogP | 4.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|