C26H32O5S2 — CID 11957785
methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 11957785) has the molecular formula C26H32O5S2 and a molecular weight of 488.67 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 11957785 |
| Molecular Formula | C26H32O5S2 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32O5S2/c1-31-25(30)17-32-13-4-14-33-26-22(23(28)16-24(26)29)12-11-21(27)10-8-18-7-9-19-5-2-3-6-20(19)15-18/h2-3,5-7,9,11-12,15,21-23,26-28H,4,8,10,13-14,16-17H2,1H3/b12-11+/t21-,22-,23+,26+/m0/s1 |
| InChIKey | VGGQXJRDBYVGMO-NOZZFJTASA-N |
| XLogP | 4.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|