C21H28O5S2 — CID 69338054
methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 69338054) has the molecular formula C21H28O5S2 and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 69338054 |
| Molecular Formula | C21H28O5S2 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-[(E)-3-hydroxy-4-phenylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/C(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H28O5S2/c1-26-20(25)14-27-10-5-11-28-21-17(18(23)13-19(21)24)9-8-16(22)12-15-6-3-2-4-7-15/h2-4,6-9,16-18,21-23H,5,10-14H2,1H3/b9-8+/t16?,17-,18+,21+/m0/s1 |
| InChIKey | MFQCVLOXVMIEAR-NDXVEAPASA-N |
| XLogP | 2.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|