C25H30O5S2 — CID 66861034
methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-(3-hydroxy-4-naphthalen-2-ylbut-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 66861034) has the molecular formula C25H30O5S2 and a molecular weight of 474.64 g/mol. Its IUPAC name is methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-(3-hydroxy-4-naphthalen-2-ylbut-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-(3-hydroxy-4-naphthalen-2-ylbut-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 66861034 |
| Molecular Formula | C25H30O5S2 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | methyl 2-[3-[(1R,2S,3R)-3-hydroxy-2-(3-hydroxy-4-naphthalen-2-ylbut-1-enyl)-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | COC(=O)CSCCCS[C@H]1C(=O)C[C@@H](O)[C@@H]1C=CC(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H30O5S2/c1-30-24(29)16-31-11-4-12-32-25-21(22(27)15-23(25)28)10-9-20(26)14-17-7-8-18-5-2-3-6-19(18)13-17/h2-3,5-10,13,20-22,25-27H,4,11-12,14-16H2,1H3/t20?,21-,22+,25+/m0/s1 |
| InChIKey | DBKUSERGBMDWBU-UHOARXMQSA-N |
| XLogP | 3.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|