C23H28O4S3 — CID 67018693
2-[3-[(1R,2S)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 67018693) has the molecular formula C23H28O4S3 and a molecular weight of 464.67 g/mol. Its IUPAC name is 2-[3-[(1R,2S)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(1R,2S)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 67018693 |
| Molecular Formula | C23H28O4S3 |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[3-[(1R,2S)-2-[(3S)-5-(1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCS[C@H]1C(=O)CC[C@H]1C=C[C@@H](O)CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C23H28O4S3/c24-18(9-10-19-14-17-4-1-2-5-21(17)30-19)8-6-16-7-11-20(25)23(16)29-13-3-12-28-15-22(26)27/h1-2,4-6,8,14,16,18,23-24H,3,7,9-13,15H2,(H,26,27)/t16-,18-,23-/m1/s1 |
| InChIKey | UTZZXFGMUNYLMU-JTUHZDRVSA-N |
| XLogP | 5.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|