C24H28O4S2 — CID 21091260
2-[3-[2-[(E)-3-hydroxy-4-naphthalen-2-ylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 21091260) has the molecular formula C24H28O4S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 2-[3-[2-[(E)-3-hydroxy-4-naphthalen-2-ylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[2-[(E)-3-hydroxy-4-naphthalen-2-ylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 21091260 |
| Molecular Formula | C24H28O4S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[3-[2-[(E)-3-hydroxy-4-naphthalen-2-ylbut-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCSC1C(=O)CCC1/C=C/C(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H28O4S2/c25-21(15-17-6-7-18-4-1-2-5-20(18)14-17)10-8-19-9-11-22(26)24(19)30-13-3-12-29-16-23(27)28/h1-2,4-8,10,14,19,21,24-25H,3,9,11-13,15-16H2,(H,27,28)/b10-8+ |
| InChIKey | VQUZHZXOQNRGHQ-CSKARUKUSA-N |
| XLogP | 4.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|