C16H18O3 — CID 57253905
cis-(3R,4R)-4-hydroxy-3-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-2-methylidenecyclopentan-1-one (PubChem CID 57253905) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is cis-(3R,4R)-4-hydroxy-3-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-2-methylidenecyclopentan-1-one.
| Compound Name | cis-(3R,4R)-4-hydroxy-3-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 57253905 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | cis-(3R,4R)-4-hydroxy-3-[(3S)-3-hydroxy-4-phenylbut-1-enyl]-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-11-14(16(19)10-15(11)18)8-7-13(17)9-12-5-3-2-4-6-12/h2-8,13-14,16-17,19H,1,9-10H2/t13-,14-,16-/m1/s1 |
| InChIKey | JMRRQUYDEHMRSU-IIAWOOMASA-N |
| XLogP | 1.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|