C15H22O3 — CID 139625976
cis-(3R,4R)-3-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-4-hydroxy-2-methylidenecyclopentan-1-one (PubChem CID 139625976) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is cis-(3R,4R)-3-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-4-hydroxy-2-methylidenecyclopentan-1-one.
| Compound Name | cis-(3R,4R)-3-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-4-hydroxy-2-methylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 139625976 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | cis-(3R,4R)-3-[(E,3S)-4-cyclopentyl-3-hydroxybut-1-enyl]-4-hydroxy-2-methylidenecyclopentan-1-one |
| SMILES | C=C1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)CC1CCCC1 |
| InChI | InChI=1S/C15H22O3/c1-10-13(15(18)9-14(10)17)7-6-12(16)8-11-4-2-3-5-11/h6-7,11-13,15-16,18H,1-5,8-9H2/b7-6+/t12-,13-,15-/m1/s1 |
| InChIKey | FETZIFRIYFUZGX-BRXCMBGASA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|