C24H38O4 — CID 67929540
4-[(1S,2S,3S,6R)-2-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 67929540) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 4-[(1S,2S,3S,6R)-2-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1S,2S,3S,6R)-2-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 67929540 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 4-[(1S,2S,3S,6R)-2-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CC1C(=CCCC(=O)O)[C@]2(C)CC[C@H](O)[C@@H](/C=C/C(O)CC3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C24H38O4/c1-16-20(9-6-10-22(27)28)24(2)14-13-21(26)19(23(16)24)12-11-18(25)15-17-7-4-3-5-8-17/h9,11-12,16-19,21,23,25-26H,3-8,10,13-15H2,1-2H3,(H,27,28)/b12-11+,20-9?/t16?,18?,19-,21+,23+,24+/m1/s1 |
| InChIKey | PXHLEPFBJHAWDI-ZAYRPYCESA-N |
| XLogP | 4.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|