C24H40O5 — CID 70425901
5-[(1S,2S,3S,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-3-hydroxy-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid (PubChem CID 70425901) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 5-[(1S,2S,3S,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-3-hydroxy-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid.
| Compound Name | 5-[(1S,2S,3S,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-3-hydroxy-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid |
|---|---|
| PubChem CID | 70425901 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 5-[(1S,2S,3S,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-3-hydroxy-6-methoxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid |
| SMILES | CO[C@@]12CC[C@H](O)[C@@H](CCC(O)C3CCCCC3)[C@@H]1C(C)C2=CCCCC(=O)O |
| InChI | InChI=1S/C24H40O5/c1-16-19(10-6-7-11-22(27)28)24(29-2)15-14-21(26)18(23(16)24)12-13-20(25)17-8-4-3-5-9-17/h10,16-18,20-21,23,25-26H,3-9,11-15H2,1-2H3,(H,27,28)/t16?,18-,20?,21+,23+,24-/m1/s1 |
| InChIKey | AULXRGYEHSEPOI-ITAKRLBXSA-N |
| XLogP | 4.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|