C28H48O4 — CID 67929713
4-[(1R,2R,3R,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-8-hexyl-3-hydroxy-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 67929713) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 4-[(1R,2R,3R,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-8-hexyl-3-hydroxy-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1R,2R,3R,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-8-hexyl-3-hydroxy-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 67929713 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 4-[(1R,2R,3R,6S)-2-(3-cyclohexyl-3-hydroxypropyl)-8-hexyl-3-hydroxy-6-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CCCCCCC1C(=CCCC(=O)O)[C@@]2(C)CC[C@@H](O)[C@H](CCC(O)C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C28H48O4/c1-3-4-5-9-13-21-23(14-10-15-26(31)32)28(2)19-18-25(30)22(27(21)28)16-17-24(29)20-11-7-6-8-12-20/h14,20-22,24-25,27,29-30H,3-13,15-19H2,1-2H3,(H,31,32)/t21?,22-,24?,25+,27+,28+/m0/s1 |
| InChIKey | MZSPSKSGOFUTAI-LCNXFJGZSA-N |
| XLogP | 6.49 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|