C26H40O5 — CID 57110430
4-[(1R,2S,3R,6R)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 57110430) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is 4-[(1R,2S,3R,6R)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1R,2S,3R,6R)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 57110430 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 4-[(1R,2S,3R,6R)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CCCCC1C(=CCCC(=O)O)[C@@]2(OC)CC[C@@H](O)[C@H](C#CC(O)C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C26H40O5/c1-3-4-11-19-21(12-8-13-24(29)30)26(31-2)17-16-23(28)20(25(19)26)14-15-22(27)18-9-6-5-7-10-18/h12,18-20,22-23,25,27-28H,3-11,13,16-17H2,1-2H3,(H,29,30)/t19?,20-,22?,23+,25+,26-/m0/s1 |
| InChIKey | AYAZRFANEBPZMT-MTQHUPLNSA-N |
| XLogP | 4.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|