C23H31F3O5 — CID 22837611
(4E)-4-[(1S,2R,3S,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-(2,2,2-trifluoroethoxy)-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 22837611) has the molecular formula C23H31F3O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is (4E)-4-[(1S,2R,3S,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-(2,2,2-trifluoroethoxy)-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4E)-4-[(1S,2R,3S,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-(2,2,2-trifluoroethoxy)-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 22837611 |
| Molecular Formula | C23H31F3O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (4E)-4-[(1S,2R,3S,6S)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-(2,2,2-trifluoroethoxy)-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | O=C(O)CC/C=C1\C[C@H]2[C@H](C#CC(O)C3CCCCC3)[C@@H](O)CC[C@@]12OCC(F)(F)F |
| InChI | InChI=1S/C23H31F3O5/c24-23(25,26)14-31-22-12-11-20(28)17(9-10-19(27)15-5-2-1-3-6-15)18(22)13-16(22)7-4-8-21(29)30/h7,15,17-20,27-28H,1-6,8,11-14H2,(H,29,30)/b16-7+/t17-,18-,19?,20-,22+/m0/s1 |
| InChIKey | WRVKVRHPXIEJHX-YLRCANEMSA-N |
| XLogP | 3.83 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|