C22H32O5 — CID 70403756
(4Z)-4-[(1R,2S,3R,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 70403756) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (4Z)-4-[(1R,2S,3R,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4Z)-4-[(1R,2S,3R,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 70403756 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (4Z)-4-[(1R,2S,3R,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-6-methoxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CO[C@]12CC[C@@H](O)[C@H](C#CC(O)C3CCCCC3)[C@H]1C/C2=C/CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-27-22-13-12-20(24)17(10-11-19(23)15-6-3-2-4-7-15)18(22)14-16(22)8-5-9-21(25)26/h8,15,17-20,23-24H,2-7,9,12-14H2,1H3,(H,25,26)/b16-8-/t17-,18-,19?,20-,22+/m1/s1 |
| InChIKey | APECSNODFMBZPZ-TUXDYATMSA-N |
| XLogP | 2.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|