C23H34O4 — CID 18642749
(4E)-4-[(1S,2R,3S,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-6-ethyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 18642749) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (4E)-4-[(1S,2R,3S,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-6-ethyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4E)-4-[(1S,2R,3S,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-6-ethyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 18642749 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (4E)-4-[(1S,2R,3S,6R)-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-6-ethyl-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CC[C@@]12CC[C@H](O)[C@@H](C#CC(O)C3CCCCC3)[C@@H]1C/C2=C\CCC(=O)O |
| InChI | InChI=1S/C23H34O4/c1-2-23-14-13-21(25)18(11-12-20(24)16-7-4-3-5-8-16)19(23)15-17(23)9-6-10-22(26)27/h9,16,18-21,24-25H,2-8,10,13-15H2,1H3,(H,26,27)/b17-9+/t18-,19-,20?,21-,23-/m0/s1 |
| InChIKey | RMRREVXAUNPEQV-SFFKKVDCSA-N |
| XLogP | 3.91 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|