C25H38O4 — CID 56606398
4-[(1S,2S,3R,6S)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 56606398) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-[(1S,2S,3R,6S)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | 4-[(1S,2S,3R,6S)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 56606398 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 4-[(1S,2S,3R,6S)-8-butyl-2-(3-cyclohexyl-3-hydroxyprop-1-ynyl)-3-hydroxy-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CCCCC1C(=CCCC(=O)O)[C@H]2CC[C@@H](O)[C@H](C#CC(O)C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C25H38O4/c1-2-3-10-19-18(11-7-12-24(28)29)20-13-16-23(27)21(25(19)20)14-15-22(26)17-8-5-4-6-9-17/h11,17,19-23,25-27H,2-10,12-13,16H2,1H3,(H,28,29)/t19?,20-,21+,22?,23-,25+/m1/s1 |
| InChIKey | JHDOCZOBUGUQPN-OMWUCDPLSA-N |
| XLogP | 4.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|