C23H36O4 — CID 67932783
(4Z)-4-[(1R,2R,3S,6R)-3-hydroxy-2-[(5R)-3-hydroxy-5-methylnon-1-ynyl]-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 67932783) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4Z)-4-[(1R,2R,3S,6R)-3-hydroxy-2-[(5R)-3-hydroxy-5-methylnon-1-ynyl]-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4Z)-4-[(1R,2R,3S,6R)-3-hydroxy-2-[(5R)-3-hydroxy-5-methylnon-1-ynyl]-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 67932783 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (4Z)-4-[(1R,2R,3S,6R)-3-hydroxy-2-[(5R)-3-hydroxy-5-methylnon-1-ynyl]-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CCCC[C@@H](C)CC(O)C#C[C@H]1[C@@H]2C(C)/C(=C/CCC(=O)O)[C@@H]2CC[C@@H]1O |
| InChI | InChI=1S/C23H36O4/c1-4-5-7-15(2)14-17(24)10-11-20-21(25)13-12-19-18(16(3)23(19)20)8-6-9-22(26)27/h8,15-17,19-21,23-25H,4-7,9,12-14H2,1-3H3,(H,26,27)/b18-8-/t15-,16?,17?,19+,20-,21+,23-/m1/s1 |
| InChIKey | PMKSMXCFCPRCPF-BWEKBOGESA-N |
| XLogP | 4.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|