C19H30O3 — CID 56627132
(1S,2S,3R,6S)-3-hydroxy-2-[(3S,5S)-3-hydroxy-5-methylnon-1-ynyl]-8-methylbicyclo[4.2.0]octan-7-one (PubChem CID 56627132) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1S,2S,3R,6S)-3-hydroxy-2-[(3S,5S)-3-hydroxy-5-methylnon-1-ynyl]-8-methylbicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2S,3R,6S)-3-hydroxy-2-[(3S,5S)-3-hydroxy-5-methylnon-1-ynyl]-8-methylbicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 56627132 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S,2S,3R,6S)-3-hydroxy-2-[(3S,5S)-3-hydroxy-5-methylnon-1-ynyl]-8-methylbicyclo[4.2.0]octan-7-one |
| SMILES | CCCC[C@H](C)C[C@H](O)C#C[C@@H]1[C@H]2C(C)C(=O)[C@H]2CC[C@H]1O |
| InChI | InChI=1S/C19H30O3/c1-4-5-6-12(2)11-14(20)7-8-15-17(21)10-9-16-18(15)13(3)19(16)22/h12-18,20-21H,4-6,9-11H2,1-3H3/t12-,13?,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | BEDNZUGHYGWWPX-LECLHDLASA-N |
| XLogP | 2.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|