C24H36O4 — CID 67932679
(4Z)-4-[(1R,2R,3S,6R)-2-(4-cyclopentyl-3-hydroxybut-1-ynyl)-3-hydroxy-8-propyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 67932679) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (4Z)-4-[(1R,2R,3S,6R)-2-(4-cyclopentyl-3-hydroxybut-1-ynyl)-3-hydroxy-8-propyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4Z)-4-[(1R,2R,3S,6R)-2-(4-cyclopentyl-3-hydroxybut-1-ynyl)-3-hydroxy-8-propyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 67932679 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4Z)-4-[(1R,2R,3S,6R)-2-(4-cyclopentyl-3-hydroxybut-1-ynyl)-3-hydroxy-8-propyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | CCCC1/C(=C/CCC(=O)O)[C@@H]2CC[C@H](O)[C@@H](C#CC(O)CC3CCCC3)[C@H]12 |
| InChI | InChI=1S/C24H36O4/c1-2-6-19-18(9-5-10-23(27)28)20-13-14-22(26)21(24(19)20)12-11-17(25)15-16-7-3-4-8-16/h9,16-17,19-22,24-26H,2-8,10,13-15H2,1H3,(H,27,28)/b18-9-/t17?,19?,20-,21+,22-,24+/m0/s1 |
| InChIKey | RDXKOXXZJRDFQF-KAXAIXCHSA-N |
| XLogP | 4.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|