C21H30O3 — CID 88658508
(4Z)-4-[(1R,2S,3S,6R)-2-(3-cyclopentyl-3-hydroxyprop-1-ynyl)-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanal (PubChem CID 88658508) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (4Z)-4-[(1R,2S,3S,6R)-2-(3-cyclopentyl-3-hydroxyprop-1-ynyl)-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanal.
| Compound Name | (4Z)-4-[(1R,2S,3S,6R)-2-(3-cyclopentyl-3-hydroxyprop-1-ynyl)-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanal |
|---|---|
| PubChem CID | 88658508 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (4Z)-4-[(1R,2S,3S,6R)-2-(3-cyclopentyl-3-hydroxyprop-1-ynyl)-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanal |
| SMILES | CC1/C(=C/CCC=O)[C@@H]2CC[C@H](O)[C@H](C#CC(O)C3CCCC3)[C@H]12 |
| InChI | InChI=1S/C21H30O3/c1-14-16(8-4-5-13-22)17-9-12-20(24)18(21(14)17)10-11-19(23)15-6-2-3-7-15/h8,13-15,17-21,23-24H,2-7,9,12H2,1H3/b16-8-/t14?,17-,18-,19?,20-,21+/m0/s1 |
| InChIKey | SGOCHPKVPXRIAC-TVFXEEGMSA-N |
| XLogP | 3.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|