C17H26O3 — CID 56639095
(1S,2S,3R,6S)-3-hydroxy-2-[(3S)-3-hydroxynon-1-ynyl]bicyclo[4.2.0]octan-7-one (PubChem CID 56639095) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (1S,2S,3R,6S)-3-hydroxy-2-[(3S)-3-hydroxynon-1-ynyl]bicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2S,3R,6S)-3-hydroxy-2-[(3S)-3-hydroxynon-1-ynyl]bicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 56639095 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (1S,2S,3R,6S)-3-hydroxy-2-[(3S)-3-hydroxynon-1-ynyl]bicyclo[4.2.0]octan-7-one |
| SMILES | CCCCCC[C@H](O)C#C[C@@H]1[C@@H]2CC(=O)[C@H]2CC[C@H]1O |
| InChI | InChI=1S/C17H26O3/c1-2-3-4-5-6-12(18)7-8-13-15-11-17(20)14(15)9-10-16(13)19/h12-16,18-19H,2-6,9-11H2,1H3/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | IYLFYGSYATWWAH-XFIYOXNOSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|