C23H39NO2 — CID 21039398
(2R,3S,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3S)-3-hydroxyoct-1-ynyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039398) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3S)-3-hydroxyoct-1-ynyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3S)-3-hydroxyoct-1-ynyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039398 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (2R,3S,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3S)-3-hydroxyoct-1-ynyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC[C@H](O)C#C[C@@H]1[C@H]2CC(CCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H39NO2/c1-4-5-7-11-20(25)12-13-21-22-16-18(15-19(22)17-23(21)26)10-8-6-9-14-24(2)3/h15,19-23,25-26H,4-11,14,16-17H2,1-3H3/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | VGHUCRFUOUGPLD-USWKJHDZSA-N |
| XLogP | 4.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|