C25H47NO2 — CID 21039086
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3R)-3-hydroxy-4,4-dimethyloctyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039086) has the molecular formula C25H47NO2 and a molecular weight of 393.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3R)-3-hydroxy-4,4-dimethyloctyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3R)-3-hydroxy-4,4-dimethyloctyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039086 |
| Molecular Formula | C25H47NO2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 393.36 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(3R)-3-hydroxy-4,4-dimethyloctyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC(C)(C)[C@H](O)CC[C@@H]1[C@H]2CC(CCCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H47NO2/c1-6-7-14-25(2,3)24(28)13-12-21-22-17-19(16-20(22)18-23(21)27)11-9-8-10-15-26(4)5/h16,20-24,27-28H,6-15,17-18H2,1-5H3/t20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | WAKZTSNRMVHUGT-OEYYQIPYSA-N |
| XLogP | 5.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|