C23H40O5 — CID 22797916
7-[(1R,2R,3R)-2-[3-(1-butylcyclobutyl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid (PubChem CID 22797916) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[3-(1-butylcyclobutyl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[3-(1-butylcyclobutyl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22797916 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[3-(1-butylcyclobutyl)-3-hydroxypropyl]-3-hydroxy-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC1(C(O)CC[C@H]2[C@H](O)CC(=O)[C@@H]2CCCCCCC(=O)O)CCC1 |
| InChI | InChI=1S/C23H40O5/c1-2-3-13-23(14-8-15-23)21(26)12-11-18-17(19(24)16-20(18)25)9-6-4-5-7-10-22(27)28/h17-18,20-21,25-26H,2-16H2,1H3,(H,27,28)/t17-,18-,20-,21?/m1/s1 |
| InChIKey | GIDCXLMLSRLFPZ-HUTCVZBOSA-N |
| XLogP | 4.48 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|