C29H50O3 — CID 18642682
(1R,2S,3S,6R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one (PubChem CID 18642682) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is (1R,2S,3S,6R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one.
| Compound Name | (1R,2S,3S,6R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 18642682 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | (1R,2S,3S,6R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
| SMILES | CCCCCCC1C(=O)[C@]2(CCCCCC)CC[C@H](O)[C@@H](/C=C/[C@@H](O)C3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C29H50O3/c1-3-5-7-12-16-24-27-23(17-18-25(30)22-14-10-9-11-15-22)26(31)19-21-29(27,28(24)32)20-13-8-6-4-2/h17-18,22-27,30-31H,3-16,19-21H2,1-2H3/b18-17+/t23-,24?,25-,26+,27-,29-/m1/s1 |
| InChIKey | IFEYNDOLJYDZAD-SDEZKULSSA-N |
| XLogP | 7.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|