C22H36O5 — CID 70404327
(1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 70404327) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 70404327 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (1'S,2'R,3'R,6'R)-2'-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-6'-ethoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CCO[C@]12CC[C@@H](O)[C@H](/C=C/[C@@H](O)C3CCCCC3)[C@H]1C(C)C21OCCO1 |
| InChI | InChI=1S/C22H36O5/c1-3-25-21-12-11-19(24)17(9-10-18(23)16-7-5-4-6-8-16)20(21)15(2)22(21)26-13-14-27-22/h9-10,15-20,23-24H,3-8,11-14H2,1-2H3/b10-9+/t15?,17-,18+,19+,20+,21+/m0/s1 |
| InChIKey | JIOROJSVYFGKKF-JOKPJZCOSA-N |
| XLogP | 3.04 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|