C20H32O3 — CID 57103776
(1S,2R,3R,6S)-2-[(3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethylbicyclo[4.2.0]octan-7-one (PubChem CID 57103776) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,2R,3R,6S)-2-[(3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethylbicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2R,3R,6S)-2-[(3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethylbicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 57103776 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,2R,3R,6S)-2-[(3S)-4-cyclohexyl-3-hydroxybut-1-enyl]-3-hydroxy-6,8-dimethylbicyclo[4.2.0]octan-7-one |
| SMILES | CC1C(=O)[C@@]2(C)CC[C@@H](O)[C@H](C=C[C@@H](O)CC3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C20H32O3/c1-13-18-16(17(22)10-11-20(18,2)19(13)23)9-8-15(21)12-14-6-4-3-5-7-14/h8-9,13-18,21-22H,3-7,10-12H2,1-2H3/t13?,15-,16+,17-,18-,20+/m1/s1 |
| InChIKey | GZFAUXIKYWFXDY-UJHXGZAGSA-N |
| XLogP | 3.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|