C29H48O3 — CID 18642922
(1S,2S,3R,6S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one (PubChem CID 18642922) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (1S,2S,3R,6S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2S,3R,6S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 18642922 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (1S,2S,3R,6S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-6,8-dihexyl-3-hydroxybicyclo[4.2.0]octan-7-one |
| SMILES | CCCCCCC1C(=O)[C@@]2(CCCCCC)CC[C@@H](O)[C@H](C#C[C@@H](O)C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C29H48O3/c1-3-5-7-12-16-24-27-23(17-18-25(30)22-14-10-9-11-15-22)26(31)19-21-29(27,28(24)32)20-13-8-6-4-2/h22-27,30-31H,3-16,19-21H2,1-2H3/t23-,24?,25+,26+,27-,29-/m0/s1 |
| InChIKey | FZQNXJUVSKFVCR-CEPRZFAFSA-N |
| XLogP | 6.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|