C24H32O4 — CID 18642867
(1S,2R,3S,6R)-6-hexyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]bicyclo[4.2.0]octan-7-one (PubChem CID 18642867) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1S,2R,3S,6R)-6-hexyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]bicyclo[4.2.0]octan-7-one.
| Compound Name | (1S,2R,3S,6R)-6-hexyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]bicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 18642867 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (1S,2R,3S,6R)-6-hexyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]bicyclo[4.2.0]octan-7-one |
| SMILES | CCCCCC[C@@]12CC[C@H](O)[C@@H](C#C[C@H](O)COc3ccccc3)[C@@H]1CC2=O |
| InChI | InChI=1S/C24H32O4/c1-2-3-4-8-14-24-15-13-22(26)20(21(24)16-23(24)27)12-11-18(25)17-28-19-9-6-5-7-10-19/h5-7,9-10,18,20-22,25-26H,2-4,8,13-17H2,1H3/t18-,20-,21-,22-,24+/m0/s1 |
| InChIKey | USNUHPFXHDWACS-KUVULSONSA-N |
| XLogP | 3.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|