C21H26O4 — CID 18642792
(1R,2R,3S,6R)-8-ethyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]-6-methylbicyclo[4.2.0]octan-7-one (PubChem CID 18642792) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1R,2R,3S,6R)-8-ethyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]-6-methylbicyclo[4.2.0]octan-7-one.
| Compound Name | (1R,2R,3S,6R)-8-ethyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]-6-methylbicyclo[4.2.0]octan-7-one |
|---|---|
| PubChem CID | 18642792 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1R,2R,3S,6R)-8-ethyl-3-hydroxy-2-[(3S)-3-hydroxy-4-phenoxybut-1-ynyl]-6-methylbicyclo[4.2.0]octan-7-one |
| SMILES | CCC1C(=O)[C@]2(C)CC[C@H](O)[C@@H](C#C[C@H](O)COc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C21H26O4/c1-3-16-19-17(18(23)11-12-21(19,2)20(16)24)10-9-14(22)13-25-15-7-5-4-6-8-15/h4-8,14,16-19,22-23H,3,11-13H2,1-2H3/t14-,16?,17+,18-,19-,21+/m0/s1 |
| InChIKey | OGQZYTVRVAWTRI-ZFKHZAQDSA-N |
| XLogP | 2.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|