C28H42O6Si — CID 70403415
(1'R,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybut-1-ynyl]-6'-methoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol (PubChem CID 70403415) has the molecular formula C28H42O6Si and a molecular weight of 502.72 g/mol. Its IUPAC name is (1'R,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybut-1-ynyl]-6'-methoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol.
| Compound Name | (1'R,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybut-1-ynyl]-6'-methoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
|---|---|
| PubChem CID | 70403415 |
| Molecular Formula | C28H42O6Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (1'R,2'R,3'S,6'S)-2'-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenoxybut-1-ynyl]-6'-methoxy-8'-methylspiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octane]-3'-ol |
| SMILES | CO[C@@]12CC[C@H](O)[C@@H](C#C[C@@H](COc3ccccc3)O[Si](C)(C)C(C)(C)C)[C@@H]1C(C)C21OCCO1 |
| InChI | InChI=1S/C28H42O6Si/c1-20-25-23(24(29)15-16-27(25,30-5)28(20)32-17-18-33-28)14-13-22(34-35(6,7)26(2,3)4)19-31-21-11-9-8-10-12-21/h8-12,20,22-25,29H,15-19H2,1-7H3/t20?,22-,23+,24-,25-,27-/m0/s1 |
| InChIKey | NHILOHPQOBLUKD-MXFKXWHGSA-N |
| XLogP | 4.62 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|